What is the 5-aminohexane-1,2,3,4,6-pentol?

5-aminohexane-1,2,3,4,6-pentol is , while it's Molecular Formula is C 6 H 15 NO 5 . Used in Biotechnology and Pharmaceutical Research: 5-aminohexane-1,2,3,4,6-pentol is used as a starting material for the synthesis of various compounds, including potential drugs and bioactive molecules. Its unique structure and functional groups make it a valuable component in the development of new therapeutic agents. Used as a Chelating Agent for Metal Ions: 5-aminohexane-1,2,3,4,6-pentol is used as a chelating agent for metal ions, which can be beneficial in various industrial and medical applications. Its ability to bind metal ions can help in the detoxification process and the development of new materials with specific properties. Used as an Antioxidant: 5-aminohexane-1,2,3,4,6-pentol has shown potential as an antioxidant, which can be useful in various applications, including the food industry, cosmetics, and pharmaceuticals. Its antioxidant properties can help protect cells from oxidative stress and damage, contributing to overall health and well-being. Used in the Treatment of Neurological Disorders: 5-aminohexane-1,2,3,4,6-pentol has been investigated for its potential role in the treatment of neurological disorders due to its ability to cross the blood-brain barrier. Its presence in the brain can help modulate cellular metabolism and potentially alleviate symptoms associated with certain neurological conditions. Used in the Treatment of Metabolic Diseases: 5-aminohexane-1,2,3,4,6-pentol has also shown promise in the treatment of metabolic diseases due to its effects on cellular metabolism. Its ability to influence metabolic pathways can contribute to the management and treatment of various metabolic disorders, improving overall health outcomes.

What is the CAS number for 5-aminohexane-1,2,3,4,6-pentol?

The CAS number of 5-aminohexane-1,2,3,4,6-pentol is 2351-14-6.

What is 5-aminohexane-1,2,3,4,6-pentol (2351-14-6) used for?

5-aminohexane-1,2,3,4,6-pentol, also known as D-lyxo-hexulose-1-amino-5-phosphate, is a sugar alcohol with the molecular formula C6H15NO5. It contains an amino group and is a chemical compound of interest in various fields due to its unique properties and potential applications.InChI:InChI=1/C6H15NO5/c7-3(1-8)5(11)6(12)4(10)2-9/h3-6,8-12H,1-2,7H2

What is the 5-aminohexane-1,2,3,4,6-pentol?

5-aminohexane-1,2,3,4,6-pentol is , while it's Molecular Formula is C 6 H 15 NO 5 . Used in Biotechnology and Pharmaceutical Research: 5-aminohexane-1,2,3,4,6-pentol is used as a starting material for the synthesis of various compounds, including potential drugs and bioactive molecules. Its unique structure and functional groups make it a valuable component in the development of new therapeutic agents. Used as a Chelating Agent for Metal Ions: 5-aminohexane-1,2,3,4,6-pentol is used as a chelating agent for metal ions, which can be beneficial in various industrial and medical applications. Its ability to bind metal ions can help in the detoxification process and the development of new materials with specific properties. Used as an Antioxidant: 5-aminohexane-1,2,3,4,6-pentol has shown potential as an antioxidant, which can be useful in various applications, including the food industry, cosmetics, and pharmaceuticals. Its antioxidant properties can help protect cells from oxidative stress and damage, contributing to overall health and well-being. Used in the Treatment of Neurological Disorders: 5-aminohexane-1,2,3,4,6-pentol has been investigated for its potential role in the treatment of neurological disorders due to its ability to cross the blood-brain barrier. Its presence in the brain can help modulate cellular metabolism and potentially alleviate symptoms associated with certain neurological conditions. Used in the Treatment of Metabolic Diseases: 5-aminohexane-1,2,3,4,6-pentol has also shown promise in the treatment of metabolic diseases due to its effects on cellular metabolism. Its ability to influence metabolic pathways can contribute to the management and treatment of various metabolic disorders, improving overall health outcomes.

What is the CAS number for 5-aminohexane-1,2,3,4,6-pentol?

The CAS number of 5-aminohexane-1,2,3,4,6-pentol is 2351-14-6.

What is 5-aminohexane-1,2,3,4,6-pentol (2351-14-6) used for?

5-aminohexane-1,2,3,4,6-pentol, also known as D-lyxo-hexulose-1-amino-5-phosphate, is a sugar alcohol with the molecular formula C6H15NO5. It contains an amino group and is a chemical compound of interest in various fields due to its unique properties and potential applications.InChI:InChI=1/C6H15NO5/c7-3(1-8)5(11)6(12)4(10)2-9/h3-6,8-12H,1-2,7H2

Location：Home > Others

5-aminohexane-1,2,3,4,6-pentol

Basic Information

CAS No.: 2351-14-6
Purity: 99%

Inquiry

Details

Manufacturer Sells Best Quality 5-aminohexane-1,2,3,4,6-pentol 2351-14-6 with stock

Molecular Formula: C₆H₁₅NO₅
Molecular Weight: 181.189
Vapor Pressure: 1.78E-13mmHg at 25°C
Boiling Point: 530.7°C at 760 mmHg
PKA: 11.66±0.45(Predicted)
Flash Point: 274.7°C
PSA： 127.17000
Density: 1.506g/cm³
LogP: -2.91870

5-aminohexane-1,2,3,4,6-pentol(Cas 2351-14-6) Usage

General Description

5-aminohexane-1,2,3,4,6-pentol is a chemical compound with the molecular formula C6H15NO5. It is also known as D-lyxo-hexulose-1-amino-5-phosphate. 5-aminohexane-1,2,3,4,6-pentol is a sugar alcohol that contains an amino group. It is commonly used in biotechnology and pharmaceutical research as a starting material for the synthesis of various compounds, including potential drugs and bioactive molecules. 5-aminohexane-1,2,3,4,6-pentol has also shown potential as a chelating agent for metal ions and as an antioxidant, making it of interest for various industrial and medical applications. Additionally, this compound has been investigated for its potential role in the treatment of neurological disorders and metabolic diseases due to its ability to cross the blood-brain barrier and its effects on cellular metabolism.

InChI:InChI=1/C6H15NO5/c7-3(1-8)5(11)6(12)4(10)2-9/h3-6,8-12H,1-2,7H2